C20H24ClN3O2 — CID 68632305
[(1R)-3-[4-(4-chlorophenyl)piperazin-1-yl]-1-phenylpropyl] carbamate (PubChem CID 68632305) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is [(1R)-3-[4-(4-chlorophenyl)piperazin-1-yl]-1-phenylpropyl] carbamate.
| Compound Name | [(1R)-3-[4-(4-chlorophenyl)piperazin-1-yl]-1-phenylpropyl] carbamate |
|---|---|
| PubChem CID | 68632305 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [(1R)-3-[4-(4-chlorophenyl)piperazin-1-yl]-1-phenylpropyl] carbamate |
| SMILES | NC(=O)O[C@H](CCN1CCN(c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H24ClN3O2/c21-17-6-8-18(9-7-17)24-14-12-23(13-15-24)11-10-19(26-20(22)25)16-4-2-1-3-5-16/h1-9,19H,10-15H2,(H2,22,25)/t19-/m1/s1 |
| InChIKey | WBSQSZXEXGMKDF-LJQANCHMSA-N |
| XLogP | 3.69 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |