C20H25ClN4O2 — CID 67281993
[4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-1-phenylbutyl] carbamate (PubChem CID 67281993) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-1-phenylbutyl] carbamate.
| Compound Name | [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-1-phenylbutyl] carbamate |
|---|---|
| PubChem CID | 67281993 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-1-phenylbutyl] carbamate |
| SMILES | NC(=O)OC(CCCN1CCN(c2ncccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN4O2/c21-17-8-4-10-23-19(17)25-14-12-24(13-15-25)11-5-9-18(27-20(22)26)16-6-2-1-3-7-16/h1-4,6-8,10,18H,5,9,11-15H2,(H2,22,26) |
| InChIKey | PHLAWDNJEMYMBU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |