C26H28F2N4O — CID 10026785
2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 10026785) has the molecular formula C26H28F2N4O and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10026785 |
| Molecular Formula | C26H28F2N4O |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H28F2N4O/c27-21-9-5-19(6-10-21)23(20-7-11-22(28)12-8-20)4-2-14-31-15-17-32(18-16-31)26-24(25(29)33)3-1-13-30-26/h1,3,5-13,23H,2,4,14-18H2,(H2,29,33) |
| InChIKey | KLMRSRHIWFLPBI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |