C17H18ClFN4O — CID 99827339
2-[4-[(2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 99827339) has the molecular formula C17H18ClFN4O and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-[4-[(2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[(2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99827339 |
| Molecular Formula | C17H18ClFN4O |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[4-[(2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCN(Cc2cc(F)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H18ClFN4O/c18-15-4-3-13(19)10-12(15)11-22-6-8-23(9-7-22)17-14(16(20)24)2-1-5-21-17/h1-5,10H,6-9,11H2,(H2,20,24) |
| InChIKey | CUGCGUKWSGADBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |