C18H18F2N4O2 — CID 166195430
2-[4-(3,5-difluorobenzoyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide (PubChem CID 166195430) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[4-(3,5-difluorobenzoyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-(3,5-difluorobenzoyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166195430 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[4-(3,5-difluorobenzoyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCCN(C(=O)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C18H18F2N4O2/c19-13-9-12(10-14(20)11-13)18(26)24-6-2-5-23(7-8-24)17-15(16(21)25)3-1-4-22-17/h1,3-4,9-11H,2,5-8H2,(H2,21,25) |
| InChIKey | DLLRAVOHKNKHMF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |