C17H24N4O5 — CID 154919221
formic acid;2-[4-(oxolane-3-carbonyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide (PubChem CID 154919221) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is formic acid;2-[4-(oxolane-3-carbonyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide.
| Compound Name | formic acid;2-[4-(oxolane-3-carbonyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154919221 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | formic acid;2-[4-(oxolane-3-carbonyl)-1,4-diazepan-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCCN(C(=O)C2CCOC2)CC1.O=CO |
| InChI | InChI=1S/C16H22N4O3.CH2O2/c17-14(21)13-3-1-5-18-15(13)19-6-2-7-20(9-8-19)16(22)12-4-10-23-11-12;2-1-3/h1,3,5,12H,2,4,6-11H2,(H2,17,21);1H,(H,2,3) |
| InChIKey | LJZIIWYAQRMKPC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|