C27H31ClF2N3O+ — CID 70515531
4-[4,4-bis(4-fluorophenyl)butyl]-1-phenylpiperazin-1-ium-1-carboxamide;hydrochloride (PubChem CID 70515531) has the molecular formula C27H31ClF2N3O+ and a molecular weight of 487.01 g/mol. Its IUPAC name is 4-[4,4-bis(4-fluorophenyl)butyl]-1-phenylpiperazin-1-ium-1-carboxamide;hydrochloride.
| Compound Name | 4-[4,4-bis(4-fluorophenyl)butyl]-1-phenylpiperazin-1-ium-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70515531 |
| Molecular Formula | C27H31ClF2N3O+ |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-[4,4-bis(4-fluorophenyl)butyl]-1-phenylpiperazin-1-ium-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)[N+]1(c2ccccc2)CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H29F2N3O.ClH/c28-23-12-8-21(9-13-23)26(22-10-14-24(29)15-11-22)7-4-16-31-17-19-32(20-18-31,27(30)33)25-5-2-1-3-6-25;/h1-3,5-6,8-15,26H,4,7,16-20H2,(H-,30,33);1H/p+1 |
| InChIKey | BWVDTVYDZJXUCH-UHFFFAOYSA-O |
| XLogP | 5.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|