C21H25F2N3O — CID 14230271
4-[4,4-bis(4-fluorophenyl)butyl]piperazine-2-carboxamide (PubChem CID 14230271) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-2-carboxamide.
| Compound Name | 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 14230271 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[4,4-bis(4-fluorophenyl)butyl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CCN1 |
| InChI | InChI=1S/C21H25F2N3O/c22-17-7-3-15(4-8-17)19(16-5-9-18(23)10-6-16)2-1-12-26-13-11-25-20(14-26)21(24)27/h3-10,19-20,25H,1-2,11-14H2,(H2,24,27) |
| InChIKey | ZOQMOZXKIYOPHM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |