C32H38F2N2O8 — CID 5344757
2-[4,4-bis(4-fluorophenyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;bis((Z)-but-2-enedioic acid) (PubChem CID 5344757) has the molecular formula C32H38F2N2O8 and a molecular weight of 616.66 g/mol. Its IUPAC name is 2-[4,4-bis(4-fluorophenyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;bis((Z)-but-2-enedioic acid).
| Compound Name | 2-[4,4-bis(4-fluorophenyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 5344757 |
| Molecular Formula | C32H38F2N2O8 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 2-[4,4-bis(4-fluorophenyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;bis((Z)-but-2-enedioic acid) |
| SMILES | Fc1ccc(C(CCCN2CCN3CCCCC3C2)c2ccc(F)cc2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H30F2N2.2C4H4O4/c25-21-10-6-19(7-11-21)24(20-8-12-22(26)13-9-20)5-3-14-27-16-17-28-15-2-1-4-23(28)18-27;2*5-3(6)1-2-4(7)8/h6-13,23-24H,1-5,14-18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | CMEAHUPKWLSOBC-SPIKMXEPSA-N |
| XLogP | 4.47 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|