C23H28F2N2 — CID 1356088
(8aS)-2-[4,4-bis(4-fluorophenyl)butyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 1356088) has the molecular formula C23H28F2N2 and a molecular weight of 370.49 g/mol. Its IUPAC name is (8aS)-2-[4,4-bis(4-fluorophenyl)butyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-[4,4-bis(4-fluorophenyl)butyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 1356088 |
| Molecular Formula | C23H28F2N2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (8aS)-2-[4,4-bis(4-fluorophenyl)butyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1ccc(C(CCCN2CCN3CCC[C@H]3C2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H28F2N2/c24-20-9-5-18(6-10-20)23(19-7-11-21(25)12-8-19)4-2-13-26-15-16-27-14-1-3-22(27)17-26/h5-12,22-23H,1-4,13-17H2/t22-/m0/s1 |
| InChIKey | IMSNWRMLXLBTEF-QFIPXVFZSA-N |
| XLogP | 4.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |