C17H26FN3 — CID 79933339
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(3-fluorophenyl)-N-methylpropan-1-amine (PubChem CID 79933339) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(3-fluorophenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(3-fluorophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79933339 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(3-fluorophenyl)-N-methylpropan-1-amine |
| SMILES | CNC(CCN1CCN2CCCC2C1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H26FN3/c1-19-17(14-4-2-5-15(18)12-14)7-9-20-10-11-21-8-3-6-16(21)13-20/h2,4-5,12,16-17,19H,3,6-11,13H2,1H3 |
| InChIKey | QTBSSBZWXSFXLI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |