C16H23FN2 — CID 78986500
2-[1-(3-fluorophenyl)ethyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 78986500) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)ethyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-[1-(3-fluorophenyl)ethyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 78986500 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-[1-(3-fluorophenyl)ethyl]-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | CC(c1cccc(F)c1)N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C16H23FN2/c1-13(14-5-2-6-15(17)11-14)19-10-4-9-18-8-3-7-16(18)12-19/h2,5-6,11,13,16H,3-4,7-10,12H2,1H3 |
| InChIKey | JCNYMJBSLQSPMU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |