C16H22FN — CID 144622037
acetylene;1-fluoro-3-methylbenzene;2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 144622037) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is acetylene;1-fluoro-3-methylbenzene;2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | acetylene;1-fluoro-3-methylbenzene;2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 144622037 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | acetylene;1-fluoro-3-methylbenzene;2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C#C.C1CC2CCCN2C1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H7F.C7H13N.C2H2/c1-6-3-2-4-7(8)5-6;1-3-7-4-2-6-8(7)5-1;1-2/h2-5H,1H3;7H,1-6H2;1-2H |
| InChIKey | LVBOHVPJJPVWNN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|