C15H23F — CID 143126796
1,4-dimethylcyclohexane;1-fluoro-3-methylbenzene (PubChem CID 143126796) has the molecular formula C15H23F and a molecular weight of 222.35 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;1-fluoro-3-methylbenzene.
| Compound Name | 1,4-dimethylcyclohexane;1-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 143126796 |
| Molecular Formula | C15H23F |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1,4-dimethylcyclohexane;1-fluoro-3-methylbenzene |
| SMILES | CC1CCC(C)CC1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C8H16.C7H7F/c1-7-3-5-8(2)6-4-7;1-6-3-2-4-7(8)5-6/h7-8H,3-6H2,1-2H3;2-5H,1H3 |
| InChIKey | LCFAYEWZOMOZQM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |