C14H22 — CID 142361462
methylcyclopentane;1,3-xylene (PubChem CID 142361462) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is methylcyclopentane;1,3-xylene.
| Compound Name | methylcyclopentane;1,3-xylene |
|---|---|
| PubChem CID | 142361462 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | methylcyclopentane;1,3-xylene |
| SMILES | CC1CCCC1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C6H12/c1-7-4-3-5-8(2)6-7;1-6-4-2-3-5-6/h3-6H,1-2H3;6H,2-5H2,1H3 |
| InChIKey | BLZWUAVAIOWGOG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |