C15H24 — CID 159091428
methylcyclopentane;1,3,5-trimethylbenzene (PubChem CID 159091428) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is methylcyclopentane;1,3,5-trimethylbenzene.
| Compound Name | methylcyclopentane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 159091428 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | methylcyclopentane;1,3,5-trimethylbenzene |
| SMILES | CC1CCCC1.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C6H12/c1-7-4-8(2)6-9(3)5-7;1-6-4-2-3-5-6/h4-6H,1-3H3;6H,2-5H2,1H3 |
| InChIKey | KCCMCTJRWKRNHI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |