C14H19F — CID 126578544
2-fluoro-4-methyl-1-(4-methylcyclohexyl)benzene (PubChem CID 126578544) has the molecular formula C14H19F and a molecular weight of 206.30 g/mol. Its IUPAC name is 2-fluoro-4-methyl-1-(4-methylcyclohexyl)benzene.
| Compound Name | 2-fluoro-4-methyl-1-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 126578544 |
| Molecular Formula | C14H19F |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-fluoro-4-methyl-1-(4-methylcyclohexyl)benzene |
| SMILES | Cc1ccc(C2CCC(C)CC2)c(F)c1 |
| InChI | InChI=1S/C14H19F/c1-10-3-6-12(7-4-10)13-8-5-11(2)9-14(13)15/h5,8-10,12H,3-4,6-7H2,1-2H3 |
| InChIKey | GVBPXRXOOUQWSW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |