C20H25F3 — CID 70797583
1-[4-(difluoromethylidene)cyclohexyl]-2-fluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 70797583) has the molecular formula C20H25F3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[4-(difluoromethylidene)cyclohexyl]-2-fluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-[4-(difluoromethylidene)cyclohexyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 70797583 |
| Molecular Formula | C20H25F3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[4-(difluoromethylidene)cyclohexyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | CC1CCC(c2ccc(C3CCC(=C(F)F)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C20H25F3/c1-13-2-4-14(5-3-13)17-10-11-18(19(21)12-17)15-6-8-16(9-7-15)20(22)23/h10-15H,2-9H2,1H3 |
| InChIKey | LFAFSHOBHDIDGF-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |