C20H26FNS — CID 142237279
2-fluoro-1-isothiocyanato-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 142237279) has the molecular formula C20H26FNS and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-fluoro-1-isothiocyanato-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2-fluoro-1-isothiocyanato-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 142237279 |
| Molecular Formula | C20H26FNS |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-fluoro-1-isothiocyanato-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | CC1CCC(C2CCC(c3ccc(N=C=S)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H26FNS/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-11-20(22-13-23)19(21)12-18/h10-12,14-17H,2-9H2,1H3 |
| InChIKey | JTNFTEVHJVMKEJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|