C24H34FNS — CID 23572261
2-fluoro-1-isothiocyanato-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene (PubChem CID 23572261) has the molecular formula C24H34FNS and a molecular weight of 387.61 g/mol. Its IUPAC name is 2-fluoro-1-isothiocyanato-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene.
| Compound Name | 2-fluoro-1-isothiocyanato-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 23572261 |
| Molecular Formula | C24H34FNS |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-fluoro-1-isothiocyanato-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene |
| SMILES | CCCC1CCC(C2CCC(CCc3ccc(N=C=S)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H34FNS/c1-2-3-18-6-11-21(12-7-18)22-13-8-19(9-14-22)4-5-20-10-15-24(26-17-27)23(25)16-20/h10,15-16,18-19,21-22H,2-9,11-14H2,1H3 |
| InChIKey | OCNZTDPTXOUNQL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|