C23H36 — CID 22157204
2-[4-(4-propylcyclohexyl)cyclohexyl]ethylbenzene (PubChem CID 22157204) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-[4-(4-propylcyclohexyl)cyclohexyl]ethylbenzene.
| Compound Name | 2-[4-(4-propylcyclohexyl)cyclohexyl]ethylbenzene |
|---|---|
| PubChem CID | 22157204 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 2-[4-(4-propylcyclohexyl)cyclohexyl]ethylbenzene |
| SMILES | CCCC1CCC(C2CCC(CCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H36/c1-2-6-19-11-15-22(16-12-19)23-17-13-21(14-18-23)10-9-20-7-4-3-5-8-20/h3-5,7-8,19,21-23H,2,6,9-18H2,1H3 |
| InChIKey | QBYMQVIDPYYCQR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |