C25H35F5O — CID 18650565
1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene (PubChem CID 18650565) has the molecular formula C25H35F5O and a molecular weight of 446.54 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 18650565 |
| Molecular Formula | C25H35F5O |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethoxy)-4-[2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]benzene |
| SMILES | CCCC1CCC(C2CCC(CCc3ccc(OC(F)(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H35F5O/c1-2-3-18-6-12-21(13-7-18)22-14-8-19(9-15-22)4-5-20-10-16-23(17-11-20)31-25(29,30)24(26,27)28/h10-11,16-19,21-22H,2-9,12-15H2,1H3 |
| InChIKey | WNFLEHQLYDCZFM-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|