C18H21F5O3 — CID 173398800
1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-propylcyclohexane-1-carboxylic acid (PubChem CID 173398800) has the molecular formula C18H21F5O3 and a molecular weight of 380.35 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 173398800 |
| Molecular Formula | C18H21F5O3 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)(c2ccc(OC(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H21F5O3/c1-2-3-12-8-10-16(11-9-12,15(24)25)13-4-6-14(7-5-13)26-18(22,23)17(19,20)21/h4-7,12H,2-3,8-11H2,1H3,(H,24,25) |
| InChIKey | MZTGPDMGLJWNDP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|