C28H31NO4 — CID 172682936
1-[4-[2-cyano-3-(4-ethylphenoxy)-3-oxoprop-1-enyl]phenyl]-4-propylcyclohexane-1-carboxylic acid (PubChem CID 172682936) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[4-[2-cyano-3-(4-ethylphenoxy)-3-oxoprop-1-enyl]phenyl]-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[4-[2-cyano-3-(4-ethylphenoxy)-3-oxoprop-1-enyl]phenyl]-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 172682936 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-[4-[2-cyano-3-(4-ethylphenoxy)-3-oxoprop-1-enyl]phenyl]-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)(c2ccc(C=C(C#N)C(=O)Oc3ccc(CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H31NO4/c1-3-5-21-14-16-28(17-15-21,27(31)32)24-10-6-22(7-11-24)18-23(19-29)26(30)33-25-12-8-20(4-2)9-13-25/h6-13,18,21H,3-5,14-17H2,1-2H3,(H,31,32) |
| InChIKey | AQODNJVZSOKCGU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|