C27H23NO5 — CID 4062977
benzyl 4-[2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]oxybenzoate (PubChem CID 4062977) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is benzyl 4-[2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]oxybenzoate.
| Compound Name | benzyl 4-[2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 4062977 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | benzyl 4-[2-cyano-3-(4-propoxyphenyl)prop-2-enoyl]oxybenzoate |
| SMILES | CCCOc1ccc(C=C(C#N)C(=O)Oc2ccc(C(=O)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-2-16-31-24-12-8-20(9-13-24)17-23(18-28)27(30)33-25-14-10-22(11-15-25)26(29)32-19-21-6-4-3-5-7-21/h3-15,17H,2,16,19H2,1H3 |
| InChIKey | FVOQVUZQDOXGJR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|