C22H23NO3 — CID 2792690
(4-propan-2-ylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate (PubChem CID 2792690) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate.
| Compound Name | (4-propan-2-ylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2792690 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (4-propan-2-ylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(C=C(C#N)C(=O)Oc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-4-13-25-20-9-5-17(6-10-20)14-19(15-23)22(24)26-21-11-7-18(8-12-21)16(2)3/h5-12,14,16H,4,13H2,1-3H3 |
| InChIKey | ZSXVEUDZIHWEOE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|