C21H20BrNO3 — CID 4062979
(4-bromo-2,6-dimethylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate (PubChem CID 4062979) has the molecular formula C21H20BrNO3 and a molecular weight of 414.30 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4062979 |
| Molecular Formula | C21H20BrNO3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) 2-cyano-3-(4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(C=C(C#N)C(=O)Oc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C21H20BrNO3/c1-4-9-25-19-7-5-16(6-8-19)12-17(13-23)21(24)26-20-14(2)10-18(22)11-15(20)3/h5-8,10-12H,4,9H2,1-3H3 |
| InChIKey | ZWGQQDHLIXFZGR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|