C22H31FO2 — CID 57221369
1-(4-fluorophenyl)-4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid (PubChem CID 57221369) has the molecular formula C22H31FO2 and a molecular weight of 346.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-fluorophenyl)-4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57221369 |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-propylcyclohexyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C2CCC(C(=O)O)(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H31FO2/c1-2-3-16-4-6-17(7-5-16)18-12-14-22(15-13-18,21(24)25)19-8-10-20(23)11-9-19/h8-11,16-18H,2-7,12-15H2,1H3,(H,24,25) |
| InChIKey | MQWGCPFOIIOHRT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |