C26H35F5O3 — CID 88636319
1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid (PubChem CID 88636319) has the molecular formula C26H35F5O3 and a molecular weight of 490.55 g/mol. Its IUPAC name is 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 88636319 |
| Molecular Formula | C26H35F5O3 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)O)(c3ccc(OC(F)(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H35F5O3/c1-2-3-4-5-18-6-8-19(9-7-18)20-14-16-24(17-15-20,23(32)33)21-10-12-22(13-11-21)34-26(30,31)25(27,28)29/h10-13,18-20H,2-9,14-17H2,1H3,(H,32,33) |
| InChIKey | PFBGMTZAJKZWEP-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|