C39H52O4 — CID 89417596
[4-[4-(4-heptylcyclohexyl)-1-[4-(2-methylprop-2-enoyloxy)phenyl]cyclohexyl]phenyl] 2-methylprop-2-enoate (PubChem CID 89417596) has the molecular formula C39H52O4 and a molecular weight of 584.84 g/mol. Its IUPAC name is [4-[4-(4-heptylcyclohexyl)-1-[4-(2-methylprop-2-enoyloxy)phenyl]cyclohexyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(4-heptylcyclohexyl)-1-[4-(2-methylprop-2-enoyloxy)phenyl]cyclohexyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89417596 |
| Molecular Formula | C39H52O4 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | [4-[4-(4-heptylcyclohexyl)-1-[4-(2-methylprop-2-enoyloxy)phenyl]cyclohexyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C2(c3ccc(OC(=O)C(=C)C)cc3)CCC(C3CCC(CCCCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C39H52O4/c1-6-7-8-9-10-11-30-12-14-31(15-13-30)32-24-26-39(27-25-32,33-16-20-35(21-17-33)42-37(40)28(2)3)34-18-22-36(23-19-34)43-38(41)29(4)5/h16-23,30-32H,2,4,6-15,24-27H2,1,3,5H3 |
| InChIKey | PPUCWEKFLZBLBH-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|