C53H64O6 — CID 89417616
[4-[4-[4-[2-(4-heptylcyclohexyl)ethyl]-1-[4-[4-(2-methylprop-2-enoyloxy)phenoxy]phenyl]cyclohexyl]phenoxy]phenyl] 2-methylprop-2-enoate (PubChem CID 89417616) has the molecular formula C53H64O6 and a molecular weight of 797.09 g/mol. Its IUPAC name is [4-[4-[4-[2-(4-heptylcyclohexyl)ethyl]-1-[4-[4-(2-methylprop-2-enoyloxy)phenoxy]phenyl]cyclohexyl]phenoxy]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-[2-(4-heptylcyclohexyl)ethyl]-1-[4-[4-(2-methylprop-2-enoyloxy)phenoxy]phenyl]cyclohexyl]phenoxy]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89417616 |
| Molecular Formula | C53H64O6 |
| Molecular Weight | 797.09 g/mol |
| Exact Mass | 796.47 |
| IUPAC Name | [4-[4-[4-[2-(4-heptylcyclohexyl)ethyl]-1-[4-[4-(2-methylprop-2-enoyloxy)phenoxy]phenyl]cyclohexyl]phenoxy]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(Oc2ccc(C3(c4ccc(Oc5ccc(OC(=O)C(=C)C)cc5)cc4)CCC(CCC4CCC(CCCCCCC)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C53H64O6/c1-6-7-8-9-10-11-40-12-14-41(15-13-40)16-17-42-34-36-53(37-35-42,43-18-22-45(23-19-43)56-47-26-30-49(31-27-47)58-51(54)38(2)3)44-20-24-46(25-21-44)57-48-28-32-50(33-29-48)59-52(55)39(4)5/h18-33,40-42H,2,4,6-17,34-37H2,1,3,5H3 |
| InChIKey | RHZROMLQXOCGQF-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.09 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|