C45H58N2O2 — CID 70662865
4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]phenoxy]aniline (PubChem CID 70662865) has the molecular formula C45H58N2O2 and a molecular weight of 658.97 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]phenoxy]aniline.
| Compound Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]phenoxy]aniline |
|---|---|
| PubChem CID | 70662865 |
| Molecular Formula | C45H58N2O2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-4-[1-(4-heptylcyclohexyl)ethyl]cyclohexyl]phenoxy]aniline |
| SMILES | CCCCCCCC1CCC(C(C)C2CCC(c3ccc(Oc4ccc(N)cc4)cc3)(c3ccc(Oc4ccc(N)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C45H58N2O2/c1-3-4-5-6-7-8-34-9-11-35(12-10-34)33(2)36-29-31-45(32-30-36,37-13-21-41(22-14-37)48-43-25-17-39(46)18-26-43)38-15-23-42(24-16-38)49-44-27-19-40(47)20-28-44/h13-28,33-36H,3-12,29-32,46-47H2,1-2H3 |
| InChIKey | NIBGKJJHACMHGK-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|