C37H44N2O2 — CID 19873674
3-[4-[1-[4-(3-aminophenoxy)phenyl]-4-heptylcyclohexyl]phenoxy]aniline (PubChem CID 19873674) has the molecular formula C37H44N2O2 and a molecular weight of 548.77 g/mol. Its IUPAC name is 3-[4-[1-[4-(3-aminophenoxy)phenyl]-4-heptylcyclohexyl]phenoxy]aniline.
| Compound Name | 3-[4-[1-[4-(3-aminophenoxy)phenyl]-4-heptylcyclohexyl]phenoxy]aniline |
|---|---|
| PubChem CID | 19873674 |
| Molecular Formula | C37H44N2O2 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 3-[4-[1-[4-(3-aminophenoxy)phenyl]-4-heptylcyclohexyl]phenoxy]aniline |
| SMILES | CCCCCCCC1CCC(c2ccc(Oc3cccc(N)c3)cc2)(c2ccc(Oc3cccc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C37H44N2O2/c1-2-3-4-5-6-9-28-22-24-37(25-23-28,29-14-18-33(19-15-29)40-35-12-7-10-31(38)26-35)30-16-20-34(21-17-30)41-36-13-8-11-32(39)27-36/h7-8,10-21,26-28H,2-6,9,22-25,38-39H2,1H3 |
| InChIKey | NJLVXUVYUGJHKX-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|