C49H66N2O2 — CID 19873644
3-[4-[1-[4-(3-aminophenoxy)-3,5-dimethylphenyl]-4-(4-nonylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline (PubChem CID 19873644) has the molecular formula C49H66N2O2 and a molecular weight of 715.08 g/mol. Its IUPAC name is 3-[4-[1-[4-(3-aminophenoxy)-3,5-dimethylphenyl]-4-(4-nonylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline.
| Compound Name | 3-[4-[1-[4-(3-aminophenoxy)-3,5-dimethylphenyl]-4-(4-nonylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline |
|---|---|
| PubChem CID | 19873644 |
| Molecular Formula | C49H66N2O2 |
| Molecular Weight | 715.08 g/mol |
| Exact Mass | 714.51 |
| IUPAC Name | 3-[4-[1-[4-(3-aminophenoxy)-3,5-dimethylphenyl]-4-(4-nonylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline |
| SMILES | CCCCCCCCCC1CCC(C2CCC(c3cc(C)c(Oc4cccc(N)c4)c(C)c3)(c3cc(C)c(Oc4cccc(N)c4)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C49H66N2O2/c1-6-7-8-9-10-11-12-15-38-20-22-39(23-21-38)40-24-26-49(27-25-40,41-28-34(2)47(35(3)29-41)52-45-18-13-16-43(50)32-45)42-30-36(4)48(37(5)31-42)53-46-19-14-17-44(51)33-46/h13-14,16-19,28-33,38-40H,6-12,15,20-27,50-51H2,1-5H3 |
| InChIKey | VCYAIBQDUAJJBN-UHFFFAOYSA-N |
| XLogP | 14.09 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.08 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|