C38H46N2O2 — CID 139758884
4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-butylcyclohexyl]-2-methylphenoxy]-3-methylaniline (PubChem CID 139758884) has the molecular formula C38H46N2O2 and a molecular weight of 562.80 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-butylcyclohexyl]-2-methylphenoxy]-3-methylaniline.
| Compound Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-butylcyclohexyl]-2-methylphenoxy]-3-methylaniline |
|---|---|
| PubChem CID | 139758884 |
| Molecular Formula | C38H46N2O2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-butylcyclohexyl]-2-methylphenoxy]-3-methylaniline |
| SMILES | CCCCC1CCC(c2ccc(Oc3ccc(N)cc3C)c(C)c2)(c2ccc(Oc3ccc(N)cc3C)c(C)c2)CC1 |
| InChI | InChI=1S/C38H46N2O2/c1-6-7-8-29-17-19-38(20-18-29,30-9-13-34(25(2)21-30)41-36-15-11-32(39)23-27(36)4)31-10-14-35(26(3)22-31)42-37-16-12-33(40)24-28(37)5/h9-16,21-24,29H,6-8,17-20,39-40H2,1-5H3 |
| InChIKey | IDCFLNVWVPWCKB-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|