C45H58N2O2 — CID 19873653
4-[4-[1-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-4-(4-pentylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline (PubChem CID 19873653) has the molecular formula C45H58N2O2 and a molecular weight of 658.97 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-4-(4-pentylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline.
| Compound Name | 4-[4-[1-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-4-(4-pentylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline |
|---|---|
| PubChem CID | 19873653 |
| Molecular Formula | C45H58N2O2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | 4-[4-[1-[4-(4-aminophenoxy)-3,5-dimethylphenyl]-4-(4-pentylcyclohexyl)cyclohexyl]-2,6-dimethylphenoxy]aniline |
| SMILES | CCCCCC1CCC(C2CCC(c3cc(C)c(Oc4ccc(N)cc4)c(C)c3)(c3cc(C)c(Oc4ccc(N)cc4)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C45H58N2O2/c1-6-7-8-9-34-10-12-35(13-11-34)36-22-24-45(25-23-36,37-26-30(2)43(31(3)27-37)48-41-18-14-39(46)15-19-41)38-28-32(4)44(33(5)29-38)49-42-20-16-40(47)17-21-42/h14-21,26-29,34-36H,6-13,22-25,46-47H2,1-5H3 |
| InChIKey | NJVFVYRHURQZEQ-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|