C46H54N2O2 — CID 19927143
4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-hexylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline (PubChem CID 19927143) has the molecular formula C46H54N2O2 and a molecular weight of 666.95 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-hexylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline.
| Compound Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-hexylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline |
|---|---|
| PubChem CID | 19927143 |
| Molecular Formula | C46H54N2O2 |
| Molecular Weight | 666.95 g/mol |
| Exact Mass | 666.42 |
| IUPAC Name | 4-[4-[1-[4-(4-amino-2-methylphenoxy)-3-methylphenyl]-4-(3-hexylphenyl)cyclohexyl]-2-methylphenoxy]-3-methylaniline |
| SMILES | CCCCCCc1cccc(C2CCC(c3ccc(Oc4ccc(N)cc4C)c(C)c3)(c3ccc(Oc4ccc(N)cc4C)c(C)c3)CC2)c1 |
| InChI | InChI=1S/C46H54N2O2/c1-6-7-8-9-11-35-12-10-13-37(30-35)36-22-24-46(25-23-36,38-14-18-42(31(2)26-38)49-44-20-16-40(47)28-33(44)4)39-15-19-43(32(3)27-39)50-45-21-17-41(48)29-34(45)5/h10,12-21,26-30,36H,6-9,11,22-25,47-48H2,1-5H3 |
| InChIKey | XNCIBRZWNXVTOW-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.95 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|