C46H48F6N2O2 — CID 19927208
4-[4-[1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-4-(4-octylphenyl)cyclohexyl]-2-(trifluoromethyl)phenoxy]aniline (PubChem CID 19927208) has the molecular formula C46H48F6N2O2 and a molecular weight of 774.89 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-4-(4-octylphenyl)cyclohexyl]-2-(trifluoromethyl)phenoxy]aniline.
| Compound Name | 4-[4-[1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-4-(4-octylphenyl)cyclohexyl]-2-(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 19927208 |
| Molecular Formula | C46H48F6N2O2 |
| Molecular Weight | 774.89 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 4-[4-[1-[4-(4-aminophenoxy)-3-(trifluoromethyl)phenyl]-4-(4-octylphenyl)cyclohexyl]-2-(trifluoromethyl)phenoxy]aniline |
| SMILES | CCCCCCCCc1ccc(C2CCC(c3ccc(Oc4ccc(N)cc4)c(C(F)(F)F)c3)(c3ccc(Oc4ccc(N)cc4)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C46H48F6N2O2/c1-2-3-4-5-6-7-8-31-9-11-32(12-10-31)33-25-27-44(28-26-33,34-13-23-42(40(29-34)45(47,48)49)55-38-19-15-36(53)16-20-38)35-14-24-43(41(30-35)46(50,51)52)56-39-21-17-37(54)18-22-39/h9-24,29-30,33H,2-8,25-28,53-54H2,1H3 |
| InChIKey | RZGAYRUILHEWST-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.89 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|