C18H23F3O2 — CID 57165971
4-pentyl-1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid (PubChem CID 57165971) has the molecular formula C18H23F3O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-pentyl-1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-pentyl-1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57165971 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-pentyl-1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC1CCC(C(=O)O)(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H23F3O2/c1-2-3-4-5-12-6-8-18(9-7-12,17(22)23)13-10-14(19)16(21)15(20)11-13/h10-12H,2-9H2,1H3,(H,22,23) |
| InChIKey | DKPLPIZOLASDSN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|