C24H27F3O2 — CID 70257779
4-(4-pentylcyclohexyl)-2-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 70257779) has the molecular formula C24H27F3O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-(4-pentylcyclohexyl)-2-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 4-(4-pentylcyclohexyl)-2-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 70257779 |
| Molecular Formula | C24H27F3O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-(4-pentylcyclohexyl)-2-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)O)c(-c3cc(F)c(F)c(F)c3)c2)CC1 |
| InChI | InChI=1S/C24H27F3O2/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-11-19(24(28)29)20(12-17)18-13-21(25)23(27)22(26)14-18/h10-16H,2-9H2,1H3,(H,28,29) |
| InChIKey | NJMIKWJHSMKVIM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|