C34H38F4O2 — CID 18410852
2-fluoro-4-[4-[2-(4-heptylcyclohexyl)ethyl]phenyl]-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 18410852) has the molecular formula C34H38F4O2 and a molecular weight of 554.67 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-(4-heptylcyclohexyl)ethyl]phenyl]-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-fluoro-4-[4-[2-(4-heptylcyclohexyl)ethyl]phenyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 18410852 |
| Molecular Formula | C34H38F4O2 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 2-fluoro-4-[4-[2-(4-heptylcyclohexyl)ethyl]phenyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCCCCCCC1CCC(CCc2ccc(-c3ccc(C(=O)O)c(F)c3-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C34H38F4O2/c1-2-3-4-5-6-7-22-8-10-23(11-9-22)12-13-24-14-16-25(17-15-24)27-18-19-28(34(39)40)32(37)31(27)26-20-29(35)33(38)30(36)21-26/h14-23H,2-13H2,1H3,(H,39,40) |
| InChIKey | OAXMWTRGPHMDDR-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|