C30H36F4O2 — CID 18410732
2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 18410732) has the molecular formula C30H36F4O2 and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 18410732 |
| Molecular Formula | C30H36F4O2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(C(=O)O)c(F)c3-c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H36F4O2/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)23-14-15-24(30(35)36)28(33)27(23)22-16-25(31)29(34)26(32)17-22/h14-21H,2-13H2,1H3,(H,35,36) |
| InChIKey | COFZPLBXLXJDNG-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|