C33H51FO — CID 118283767
1-[3-fluoro-2-methyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]phenyl]propan-1-one (PubChem CID 118283767) has the molecular formula C33H51FO and a molecular weight of 482.77 g/mol. Its IUPAC name is 1-[3-fluoro-2-methyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]phenyl]propan-1-one.
| Compound Name | 1-[3-fluoro-2-methyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 118283767 |
| Molecular Formula | C33H51FO |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | 1-[3-fluoro-2-methyl-4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]cyclohexyl]phenyl]propan-1-one |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(c4ccc(C(=O)CC)c(C)c4F)CC3)CC2)CC1 |
| InChI | InChI=1S/C33H51FO/c1-4-6-7-8-24-9-11-25(12-10-24)26-13-15-27(16-14-26)28-17-19-29(20-18-28)31-22-21-30(32(35)5-2)23(3)33(31)34/h21-22,24-29H,4-20H2,1-3H3 |
| InChIKey | WUKJYMJOGIUXQQ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|