C24H35FO2 — CID 58942520
1-[3-fluoro-2-hydroxy-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]propan-1-one (PubChem CID 58942520) has the molecular formula C24H35FO2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 1-[3-fluoro-2-hydroxy-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]propan-1-one.
| Compound Name | 1-[3-fluoro-2-hydroxy-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 58942520 |
| Molecular Formula | C24H35FO2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[3-fluoro-2-hydroxy-4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]propan-1-one |
| SMILES | CCCC1CCC(C2CCC(c3ccc(C(=O)CC)c(O)c3F)CC2)CC1 |
| InChI | InChI=1S/C24H35FO2/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(22(26)4-2)24(27)23(20)25/h14-19,27H,3-13H2,1-2H3 |
| InChIKey | JGIQZAATNZDLNW-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |