C19H25F3O2 — CID 58942432
1-[2-hydroxy-4-(4-propylcyclohexyl)-3-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 58942432) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[2-hydroxy-4-(4-propylcyclohexyl)-3-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-[2-hydroxy-4-(4-propylcyclohexyl)-3-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 58942432 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[2-hydroxy-4-(4-propylcyclohexyl)-3-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CCCC1CCC(c2ccc(C(=O)CC)c(O)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H25F3O2/c1-3-5-12-6-8-13(9-7-12)14-10-11-15(16(23)4-2)18(24)17(14)19(20,21)22/h10-13,24H,3-9H2,1-2H3 |
| InChIKey | WQQYGQCAFHBWSA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |