C21H24F4O — CID 118287037
1-[3-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]-2-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 118287037) has the molecular formula C21H24F4O and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]-2-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-[3-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]-2-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 118287037 |
| Molecular Formula | C21H24F4O |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[3-fluoro-4-[2-(4-propylcyclohexyl)ethynyl]-2-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CCCC1CCC(C#Cc2ccc(C(=O)CC)c(C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C21H24F4O/c1-3-5-14-6-8-15(9-7-14)10-11-16-12-13-17(18(26)4-2)19(20(16)22)21(23,24)25/h12-15H,3-9H2,1-2H3 |
| InChIKey | MLOOJCDOGZAIIG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|