C17H20F4O — CID 131991209
1-[3-fluoro-4-(4-methylcyclohexyl)-2-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 131991209) has the molecular formula C17H20F4O and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methylcyclohexyl)-2-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-[3-fluoro-4-(4-methylcyclohexyl)-2-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 131991209 |
| Molecular Formula | C17H20F4O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[3-fluoro-4-(4-methylcyclohexyl)-2-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(C2CCC(C)CC2)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C17H20F4O/c1-3-14(22)13-9-8-12(11-6-4-10(2)5-7-11)16(18)15(13)17(19,20)21/h8-11H,3-7H2,1-2H3 |
| InChIKey | GUFJLVMKNWTAPX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |