C24H26F4O2 — CID 118287217
1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]-2-[4-(4-methylcyclohexyl)phenyl]ethanone (PubChem CID 118287217) has the molecular formula C24H26F4O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]-2-[4-(4-methylcyclohexyl)phenyl]ethanone.
| Compound Name | 1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]-2-[4-(4-methylcyclohexyl)phenyl]ethanone |
|---|---|
| PubChem CID | 118287217 |
| Molecular Formula | C24H26F4O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]-2-[4-(4-methylcyclohexyl)phenyl]ethanone |
| SMILES | CCOc1ccc(C(=O)Cc2ccc(C3CCC(C)CC3)cc2)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C24H26F4O2/c1-3-30-21-13-12-19(22(23(21)25)24(26,27)28)20(29)14-16-6-10-18(11-7-16)17-8-4-15(2)5-9-17/h6-7,10-13,15,17H,3-5,8-9,14H2,1-2H3 |
| InChIKey | PVSGQWHNGFEERW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |