C23H24F4O2 — CID 131991313
2-(4-cyclohexylphenyl)-1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 131991313) has the molecular formula C23H24F4O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)-1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(4-cyclohexylphenyl)-1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 131991313 |
| Molecular Formula | C23H24F4O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-(4-cyclohexylphenyl)-1-[4-ethoxy-3-fluoro-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCOc1ccc(C(=O)Cc2ccc(C3CCCCC3)cc2)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C23H24F4O2/c1-2-29-20-13-12-18(21(22(20)24)23(25,26)27)19(28)14-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h8-13,16H,2-7,14H2,1H3 |
| InChIKey | DSVMVRCPPDVVCO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |