C28H36F2O3 — CID 54408431
(4-cyclohexylphenyl) 2,3-difluoro-4-nonoxybenzoate (PubChem CID 54408431) has the molecular formula C28H36F2O3 and a molecular weight of 458.59 g/mol. Its IUPAC name is (4-cyclohexylphenyl) 2,3-difluoro-4-nonoxybenzoate.
| Compound Name | (4-cyclohexylphenyl) 2,3-difluoro-4-nonoxybenzoate |
|---|---|
| PubChem CID | 54408431 |
| Molecular Formula | C28H36F2O3 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (4-cyclohexylphenyl) 2,3-difluoro-4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(C3CCCCC3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H36F2O3/c1-2-3-4-5-6-7-11-20-32-25-19-18-24(26(29)27(25)30)28(31)33-23-16-14-22(15-17-23)21-12-9-8-10-13-21/h14-19,21H,2-13,20H2,1H3 |
| InChIKey | KPOXBZMZKVPYGH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|